CAS 221666-24-6 is the registry number for 4'-Nitro-[1,1'-biphenyl]-4-thiol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-nitrophenyl)benzenethiol (CAS 221666-24-6) is a chemical compound with the molecular formula C12H9NO2S and a molecular weight of 231.27 g/mol. IUPAC name: 4-(4-nitrophenyl)benzenethiol. InChIKey: LKMXQNGHQPUEDY-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2S |
|---|---|
| Molecular weight | 231.27 g/mol |
| IUPAC name | 4-(4-nitrophenyl)benzenethiol |
| InChIKey | LKMXQNGHQPUEDY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)S)[N+](=O)[O-] |
Computed by PubChem (NCBI)