Products 1220449-29-5
CAS 1220449-29-5 is the registry number for Ethyl 2-ethynylbenzo[d]thiazole-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-ethynyl-1,3-benzothiazole-6-carboxylate (CAS 1220449-29-5) is a chemical compound with the molecular formula C12H9NO2S and a molecular weight of 231.27 g/mol. IUPAC name: ethyl 2-ethynyl-1,3-benzothiazole-6-carboxylate. InChIKey: CCAGEUBNPDRHFX-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2S |
|---|---|
| Molecular weight | 231.27 g/mol |
| IUPAC name | ethyl 2-ethynyl-1,3-benzothiazole-6-carboxylate |
| InChIKey | CCAGEUBNPDRHFX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)N=C(S2)C#C |
Computed by PubChem (NCBI)