CAS 172869-21-5 is the registry number for 8-Methyl-8H-thieno(2,3-b)indole-2-carboxylic acid, 90%. Offered by: AmBeed. Available pack sizes: 1g.
4-methylthieno[2,3-b]indole-2-carboxylic acid (CAS 172869-21-5) is a chemical compound with the molecular formula C12H9NO2S and a molecular weight of 231.27 g/mol. IUPAC name: 4-methylthieno[2,3-b]indole-2-carboxylic acid. InChIKey: JHFVKRLBHYSSBD-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2S |
|---|---|
| Molecular weight | 231.27 g/mol |
| IUPAC name | 4-methylthieno[2,3-b]indole-2-carboxylic acid |
| InChIKey | JHFVKRLBHYSSBD-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C3=C1SC(=C3)C(=O)O |
Computed by PubChem (NCBI)