Products 1597410-51-9
CAS 1597410-51-9 is the registry number for (E)-S-Methyl 4-(3-cyanophenyl)-2-oxobut-3-enethioate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
S-methyl (E)-4-(3-cyanophenyl)-2-oxobut-3-enethioate (CAS 1597410-51-9) is a chemical compound with the molecular formula C12H9NO2S and a molecular weight of 231.27 g/mol. IUPAC name: S-methyl (E)-4-(3-cyanophenyl)-2-oxobut-3-enethioate. InChIKey: ZFOXJWCBUMGOSQ-AATRIKPKSA-N.
| Molecular formula | C12H9NO2S |
|---|---|
| Molecular weight | 231.27 g/mol |
| IUPAC name | S-methyl (E)-4-(3-cyanophenyl)-2-oxobut-3-enethioate |
| InChIKey | ZFOXJWCBUMGOSQ-AATRIKPKSA-N |
| SMILES | CSC(=O)C(=O)/C=C/C1=CC(=CC=C1)C#N |
Computed by PubChem (NCBI)