CAS 1209116-36-8 is the registry number for 5-Bromo-N-((1,1-dioxidotetrahydrothiophen-3-yl)methyl)furan-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]furan-2-carboxamide (CAS 1209116-36-8) is a chemical compound with the molecular formula C10H12BrNO4S and a molecular weight of 322.18 g/mol. IUPAC name: 5-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]furan-2-carboxamide. InChIKey: JTJARSUEGPVWRW-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO4S |
|---|---|
| Molecular weight | 322.18 g/mol |
| IUPAC name | 5-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]furan-2-carboxamide |
| InChIKey | JTJARSUEGPVWRW-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1CNC(=O)C2=CC=C(O2)Br |
Computed by PubChem (NCBI)