Products 1515323-52-0

CAS 1515323-52-0 is the registry number for 3-Bromo-5-(propane-2-sulfonylamino)-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-bromo-5-(propan-2-ylsulfonylamino)benzoic acid (CAS 1515323-52-0) is a chemical compound with the molecular formula C10H12BrNO4S and a molecular weight of 322.18 g/mol. IUPAC name: 3-bromo-5-(propan-2-ylsulfonylamino)benzoic acid. InChIKey: YTUKTCXDLGFBQW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12BrNO4S
Molecular weight322.18 g/mol
IUPAC name3-bromo-5-(propan-2-ylsulfonylamino)benzoic acid
InChIKeyYTUKTCXDLGFBQW-UHFFFAOYSA-N
SMILESCC(C)S(=O)(=O)NC1=CC(=CC(=C1)C(=O)O)Br

Computed by PubChem (NCBI)