Products 1515323-52-0
CAS 1515323-52-0 is the registry number for 3-Bromo-5-(propane-2-sulfonylamino)-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-bromo-5-(propan-2-ylsulfonylamino)benzoic acid (CAS 1515323-52-0) is a chemical compound with the molecular formula C10H12BrNO4S and a molecular weight of 322.18 g/mol. IUPAC name: 3-bromo-5-(propan-2-ylsulfonylamino)benzoic acid. InChIKey: YTUKTCXDLGFBQW-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO4S |
|---|---|
| Molecular weight | 322.18 g/mol |
| IUPAC name | 3-bromo-5-(propan-2-ylsulfonylamino)benzoic acid |
| InChIKey | YTUKTCXDLGFBQW-UHFFFAOYSA-N |
| SMILES | CC(C)S(=O)(=O)NC1=CC(=CC(=C1)C(=O)O)Br |
Computed by PubChem (NCBI)