Products 701259-91-8
CAS 701259-91-8 appears in our catalog under these names: 2-Bromo-5-[(isopropylamino)sulfonyl]benzoic acid, 95%, 2-Bromo-5-((propan-2-yl)sulfamoyl)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-bromo-5-(propan-2-ylsulfamoyl)benzoic acid (CAS 701259-91-8) is a chemical compound with the molecular formula C10H12BrNO4S and a molecular weight of 322.18 g/mol. IUPAC name: 2-bromo-5-(propan-2-ylsulfamoyl)benzoic acid. InChIKey: JOYHRQMOHPQWII-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO4S |
|---|---|
| Molecular weight | 322.18 g/mol |
| IUPAC name | 2-bromo-5-(propan-2-ylsulfamoyl)benzoic acid |
| InChIKey | JOYHRQMOHPQWII-UHFFFAOYSA-N |
| SMILES | CC(C)NS(=O)(=O)C1=CC(=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)