Products 2922283-50-7
CAS 2922283-50-7 is the registry number for N-((3-(4-Bromophenyl)propanoyl)oxy)methanesulfonamide, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Methanesulfonamido 3-(4-bromophenyl)propanoate (CAS 2922283-50-7) is a chemical compound with the molecular formula C10H12BrNO4S and a molecular weight of 322.18 g/mol. IUPAC name: methanesulfonamido 3-(4-bromophenyl)propanoate. InChIKey: MGLSPRRHWDZMLO-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO4S |
|---|---|
| Molecular weight | 322.18 g/mol |
| IUPAC name | methanesulfonamido 3-(4-bromophenyl)propanoate |
| InChIKey | MGLSPRRHWDZMLO-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NOC(=O)CCC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)