CAS 923010-34-8 appears in our catalog under these names: 5-Bromo-2-(boc-amino)thiophene-3-carboxylic acid, 95%, 5-Bromo-2-(boc-amino)thiophene-3-carboxylic acid, >95%, >95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 1g, 100mg.
5-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-3-carboxylic acid (CAS 923010-34-8) is a chemical compound with the molecular formula C10H12BrNO4S and a molecular weight of 322.18 g/mol. IUPAC name: 5-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-3-carboxylic acid. InChIKey: LWNYBNYYXKQJIV-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO4S |
|---|---|
| Molecular weight | 322.18 g/mol |
| IUPAC name | 5-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-3-carboxylic acid |
| InChIKey | LWNYBNYYXKQJIV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(S1)Br)C(=O)O |
Computed by PubChem (NCBI)