CAS 1209246-34-3 appears in our catalog under these names: 2,6-Dichloro-5-nitroquinoline, 96%, 2，6-Dichloro-5-nitroquinoline, 98%, 98%, 2,6-Dichloro-5-nitroquinoline, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g.
2,6-dichloro-5-nitroquinoline (CAS 1209246-34-3) is a chemical compound with the molecular formula C9H4Cl2N2O2 and a molecular weight of 243.04 g/mol. IUPAC name: 2,6-dichloro-5-nitroquinoline. InChIKey: RYXCRTPDGCOPAP-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2N2O2 |
|---|---|
| Molecular weight | 243.04 g/mol |
| IUPAC name | 2,6-dichloro-5-nitroquinoline |
| InChIKey | RYXCRTPDGCOPAP-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C(=C(C=C2)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)