CAS 132521-66-5 appears in our catalog under these names: 2,4-Dichloro-3-nitroquinoline, >95% (HPLC), 2,4–Dichloro–3–nitroquinoline, 2,4-Dichloro-3-nitroquinoline, 2,4-Dichloro-3-nitroquinoline 95%, 2,4-Dichloro-3-nitroquinoline, 95%, 95%. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 10mg, 50mg, 1g, 250mg, 5g, 10g, 25g.
2,4-dichloro-3-nitroquinoline (CAS 132521-66-5) is a chemical compound with the molecular formula C9H4Cl2N2O2 and a molecular weight of 243.04 g/mol. IUPAC name: 2,4-dichloro-3-nitroquinoline. InChIKey: RSFJVCHKGRUCIC-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2N2O2 |
|---|---|
| Molecular weight | 243.04 g/mol |
| IUPAC name | 2,4-dichloro-3-nitroquinoline |
| InChIKey | RSFJVCHKGRUCIC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C(=N2)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)