CAS 1506431-22-6 is the registry number for 1,7-Dichloro-5-nitroisoquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,7-dichloro-5-nitroisoquinoline (CAS 1506431-22-6) is a chemical compound with the molecular formula C9H4Cl2N2O2 and a molecular weight of 243.04 g/mol. IUPAC name: 1,7-dichloro-5-nitroisoquinoline. InChIKey: HMPXGHZBFTYAFK-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2N2O2 |
|---|---|
| Molecular weight | 243.04 g/mol |
| IUPAC name | 1,7-dichloro-5-nitroisoquinoline |
| InChIKey | HMPXGHZBFTYAFK-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C2=C1C(=CC(=C2)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)