CAS 2089652-19-5 is the registry number for 5,8-Dichloro-7-nitroquinoline, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
5,8-dichloro-7-nitroquinoline (CAS 2089652-19-5) is a chemical compound with the molecular formula C9H4Cl2N2O2 and a molecular weight of 243.04 g/mol. IUPAC name: 5,8-dichloro-7-nitroquinoline. InChIKey: GSQCTTWABNRYKJ-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2N2O2 |
|---|---|
| Molecular weight | 243.04 g/mol |
| IUPAC name | 5,8-dichloro-7-nitroquinoline |
| InChIKey | GSQCTTWABNRYKJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C(=C2N=C1)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)