CAS 1779133-04-8 is the registry number for 3-(2,5-Dichlorophenyl)-1,2,4-oxadiazole-5-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,5-dichlorophenyl)-1,2,4-oxadiazole-5-carbaldehyde (CAS 1779133-04-8) is a chemical compound with the molecular formula C9H4Cl2N2O2 and a molecular weight of 243.04 g/mol. IUPAC name: 3-(2,5-dichlorophenyl)-1,2,4-oxadiazole-5-carbaldehyde. InChIKey: ZSNLBTACVFSDRC-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2N2O2 |
|---|---|
| Molecular weight | 243.04 g/mol |
| IUPAC name | 3-(2,5-dichlorophenyl)-1,2,4-oxadiazole-5-carbaldehyde |
| InChIKey | ZSNLBTACVFSDRC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C2=NOC(=N2)C=O)Cl |
Computed by PubChem (NCBI)