Products 120934-03-4
CAS 120934-03-4 appears in our catalog under these names: 2,2,6-Trifluorobenzo[d][1,3]dioxol-5-amine, 95%, 2,2,6-Trifluoro-benzo[1,3]dioxol-5-ylamine, 95%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 100mg, 250mg.
2,2,6-trifluoro-1,3-benzodioxol-5-amine (CAS 120934-03-4) is a chemical compound with the molecular formula C7H4F3NO2 and a molecular weight of 191.11 g/mol. IUPAC name: 2,2,6-trifluoro-1,3-benzodioxol-5-amine. InChIKey: BDVTVWOEVYKSTM-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO2 |
|---|---|
| Molecular weight | 191.11 g/mol |
| IUPAC name | 2,2,6-trifluoro-1,3-benzodioxol-5-amine |
| InChIKey | BDVTVWOEVYKSTM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=C1OC(O2)(F)F)F)N |
Computed by PubChem (NCBI)