Products 18997-12-1
CAS 18997-12-1 is the registry number for 1-chlorosulfonyloxy-4-nitro-benzene, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
1-chlorosulfonyloxy-4-nitrobenzene (CAS 18997-12-1) is a chemical compound with the molecular formula C6H4ClNO5S and a molecular weight of 237.62 g/mol. IUPAC name: 1-chlorosulfonyloxy-4-nitrobenzene. InChIKey: HBQSFSHZXMBAKL-UHFFFAOYSA-N.
| Molecular formula | C6H4ClNO5S |
|---|---|
| Molecular weight | 237.62 g/mol |
| IUPAC name | 1-chlorosulfonyloxy-4-nitrobenzene |
| InChIKey | HBQSFSHZXMBAKL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OS(=O)(=O)Cl |
Computed by PubChem (NCBI)