Products 1261760-59-1
CAS 1261760-59-1 is the registry number for 2-Hydroxy-5-nitrobenzene-1-sulfonyl chloride, 95%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 100mg.
2-hydroxy-5-nitrobenzenesulfonyl chloride (CAS 1261760-59-1) is a chemical compound with the molecular formula C6H4ClNO5S and a molecular weight of 237.62 g/mol. IUPAC name: 2-hydroxy-5-nitrobenzenesulfonyl chloride. InChIKey: YGZAEQDOCPIUPR-UHFFFAOYSA-N.
| Molecular formula | C6H4ClNO5S |
|---|---|
| Molecular weight | 237.62 g/mol |
| IUPAC name | 2-hydroxy-5-nitrobenzenesulfonyl chloride |
| InChIKey | YGZAEQDOCPIUPR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])S(=O)(=O)Cl)O |
Computed by PubChem (NCBI)