CAS 121-62-0 appears in our catalog under these names: Sulfadimethoxine EP Impurity C, 4-Acetamidobenzenesulfonic acid, 97%, 4-Acetamidobenzenesulfonic acid, 4-Acetamidobenzenesulfonic Acid, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10g, 1g.
4-acetamidobenzenesulfonic acid (CAS 121-62-0) is a chemical compound with the molecular formula C8H9NO4S and a molecular weight of 215.23 g/mol. IUPAC name: 4-acetamidobenzenesulfonic acid. InChIKey: ZQPVMSLLKQTRMG-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4S |
|---|---|
| Molecular weight | 215.23 g/mol |
| IUPAC name | 4-acetamidobenzenesulfonic acid |
| InChIKey | ZQPVMSLLKQTRMG-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)