CAS 1210-39-5 appears in our catalog under these names: 3,3-Diphenylacrylaldehyde, 95%, β–Phenylcinnamaldehyde. Offered by: Combi-blocks, Chemat Brand, GLPBio, Fluorochem. Available pack sizes: 250mg, 1g, 5g, on request.
3,3-diphenylprop-2-enal (CAS 1210-39-5) is a chemical compound with the molecular formula C15H12O and a molecular weight of 208.25 g/mol. IUPAC name: 3,3-diphenylprop-2-enal. InChIKey: MWAFWBDWAWZJGK-UHFFFAOYSA-N.
| Molecular formula | C15H12O |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 3,3-diphenylprop-2-enal |
| InChIKey | MWAFWBDWAWZJGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=CC=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)