CAS 2840-49-5 is the registry number for 2,7-Dimethyl-9h-fluoren-9-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2,7-dimethylfluoren-9-one (CAS 2840-49-5) is a chemical compound with the molecular formula C15H12O and a molecular weight of 208.25 g/mol. IUPAC name: 2,7-dimethylfluoren-9-one. InChIKey: KFDJRBSJHWTGSL-UHFFFAOYSA-N.
| Molecular formula | C15H12O |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 2,7-dimethylfluoren-9-one |
| InChIKey | KFDJRBSJHWTGSL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C3=C(C2=O)C=C(C=C3)C |
Computed by PubChem (NCBI)