Products 16618-72-7
CAS 16618-72-7 appears in our catalog under these names: 3-Phenyl-1-indanone, 95%, 3-Phenyl-2,3-Dihydro-1H-Inden-1-One, 96%, 96%, 3-Phenyl-2,3-dihydro-1H-inden-1-one. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 100mg, 250mg.
3-phenyl-2,3-dihydroinden-1-one (CAS 16618-72-7) is a chemical compound with the molecular formula C15H12O and a molecular weight of 208.25 g/mol. IUPAC name: 3-phenyl-2,3-dihydroinden-1-one. InChIKey: SIUOTMYWHGODQX-UHFFFAOYSA-N.
| Molecular formula | C15H12O |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 3-phenyl-2,3-dihydroinden-1-one |
| InChIKey | SIUOTMYWHGODQX-UHFFFAOYSA-N |
| SMILES | C1C(C2=CC=CC=C2C1=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
3-Phenyl-1-indanone, 1H-Inden-1-one, 2,3-dihydro-3-phenyl-, 1-Indanone, 3-phenyl-, 3-Phenylindanone, 4-07-00-01673 (Beilstein Handbook Reference), (+-)-3-Phenyl-1-indanone, 1H-Inden-1-one, 2,3-dihydro-3-phenyl-(9CI), 3-Phenyl-2,3-dihydro-1H-inden-1-one, 3-Phenylindan-1-one, 3-phenyl-2,3-dihydroinden-1-one