CAS 1817-49-8 appears in our catalog under these names: 1,3-Diphenyl-2-propyn-1-ol, 90% tech. grade, 1,3-Diphenylprop-2-yn-1-ol, 97%, 1,3-Diphenyl-2-propyn-1-ol, tech. 90% , 1,3-Diphenylprop-2-yn-1-ol 90% tech grade, 1,3-DIPHENYL-2-PROPYN-1-OL, 90%. Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar), Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 25g, 5g.
1,3-diphenylprop-2-yn-1-ol (CAS 1817-49-8) is a chemical compound with the molecular formula C15H12O and a molecular weight of 208.25 g/mol. IUPAC name: 1,3-diphenylprop-2-yn-1-ol. InChIKey: DZZWMODRWHHWFR-UHFFFAOYSA-N.
| Molecular formula | C15H12O |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 1,3-diphenylprop-2-yn-1-ol |
| InChIKey | DZZWMODRWHHWFR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CC(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)