CAS 16619-12-8 appears in our catalog under these names: 2-Phenyl-2,3-dihydro-1h-inden-1-one, 95%, 2–Phenyl–2,3–dihydro–1H–inden–1–one, 2-Phenyl-2,3-dihydro-1H-inden-1-one 95%, 2-Phenyl-2,3-dihydro-1H-inden-1-one, 95%, 95%, 2-Phenyl-2,3-dihydro-1H-inden-1-one. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
2-phenyl-2,3-dihydroinden-1-one (CAS 16619-12-8) is a chemical compound with the molecular formula C15H12O and a molecular weight of 208.25 g/mol. IUPAC name: 2-phenyl-2,3-dihydroinden-1-one. InChIKey: OCLCRYNZYRSURW-UHFFFAOYSA-N.
| Molecular formula | C15H12O |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 2-phenyl-2,3-dihydroinden-1-one |
| InChIKey | OCLCRYNZYRSURW-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)C2=CC=CC=C21)C3=CC=CC=C3 |
Computed by PubChem (NCBI)