CAS 1210150-00-7 is the registry number for 1-(4-Fluorobenzyl)-1H-1,2,3-triazol-5-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(4-fluorophenyl)methyl]triazol-4-amine (CAS 1210150-00-7) is a chemical compound with the molecular formula C9H9FN4 and a molecular weight of 192.19 g/mol. IUPAC name: 3-[(4-fluorophenyl)methyl]triazol-4-amine. InChIKey: MYGKOFFEQHTDFL-UHFFFAOYSA-N.
| Molecular formula | C9H9FN4 |
|---|---|
| Molecular weight | 192.19 g/mol |
| IUPAC name | 3-[(4-fluorophenyl)methyl]triazol-4-amine |
| InChIKey | MYGKOFFEQHTDFL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C(=CN=N2)N)F |
Computed by PubChem (NCBI)