CAS 1353878-22-4 is the registry number for 2-Fluoro-4-(4-methyl-1h-1,2,3-triazol-1-yl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-fluoro-4-(4-methyltriazol-1-yl)aniline (CAS 1353878-22-4) is a chemical compound with the molecular formula C9H9FN4 and a molecular weight of 192.19 g/mol. IUPAC name: 2-fluoro-4-(4-methyltriazol-1-yl)aniline. InChIKey: AVBBVLZILINETH-UHFFFAOYSA-N.
| Molecular formula | C9H9FN4 |
|---|---|
| Molecular weight | 192.19 g/mol |
| IUPAC name | 2-fluoro-4-(4-methyltriazol-1-yl)aniline |
| InChIKey | AVBBVLZILINETH-UHFFFAOYSA-N |
| SMILES | CC1=CN(N=N1)C2=CC(=C(C=C2)N)F |
Computed by PubChem (NCBI)