CAS 1338949-32-8 is the registry number for 3-(5-Fluoro-2-methylphenyl)-1H-1,2,4-triazol-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(5-fluoro-2-methylphenyl)-1H-1,2,4-triazol-3-amine (CAS 1338949-32-8) is a chemical compound with the molecular formula C9H9FN4 and a molecular weight of 192.19 g/mol. IUPAC name: 5-(5-fluoro-2-methylphenyl)-1H-1,2,4-triazol-3-amine. InChIKey: AMGWDKWPCUEPAU-UHFFFAOYSA-N.
| Molecular formula | C9H9FN4 |
|---|---|
| Molecular weight | 192.19 g/mol |
| IUPAC name | 5-(5-fluoro-2-methylphenyl)-1H-1,2,4-triazol-3-amine |
| InChIKey | AMGWDKWPCUEPAU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)F)C2=NC(=NN2)N |
Computed by PubChem (NCBI)