CAS 944896-99-5 is the registry number for (5-(3-Fluorophenyl)-4H-1,2,4-triazol-3-yl)methanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[3-(3-fluorophenyl)-1H-1,2,4-triazol-5-yl]methanamine (CAS 944896-99-5) is a chemical compound with the molecular formula C9H9FN4 and a molecular weight of 192.19 g/mol. IUPAC name: [3-(3-fluorophenyl)-1H-1,2,4-triazol-5-yl]methanamine. InChIKey: CFCJAOZEVOEOPW-UHFFFAOYSA-N.
| Molecular formula | C9H9FN4 |
|---|---|
| Molecular weight | 192.19 g/mol |
| IUPAC name | [3-(3-fluorophenyl)-1H-1,2,4-triazol-5-yl]methanamine |
| InChIKey | CFCJAOZEVOEOPW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NNC(=N2)CN |
Computed by PubChem (NCBI)