CAS 502685-68-9 appears in our catalog under these names: 5-((4-Fluorophenyl)methyl)-4H-1,2,4-triazol-3-amine, 95%, 5-((4-Fluorophenyl)methyl)-4H-1,2,4-triazol-3-amine, 3-[(4-Fluorophenyl)methyl]-1H-1,2,4-triazol-5-amine, 95%, 95%, 5-[(4-fluorophenyl)methyl]-4h-1,2,4-triazol-3-amine, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 50mg, 0,5g, 100mg, 250mg.
5-[(4-fluorophenyl)methyl]-1H-1,2,4-triazol-3-amine (CAS 502685-68-9) is a chemical compound with the molecular formula C9H9FN4 and a molecular weight of 192.19 g/mol. IUPAC name: 5-[(4-fluorophenyl)methyl]-1H-1,2,4-triazol-3-amine. InChIKey: WKTGLFHOWNWTRI-UHFFFAOYSA-N.
| Molecular formula | C9H9FN4 |
|---|---|
| Molecular weight | 192.19 g/mol |
| IUPAC name | 5-[(4-fluorophenyl)methyl]-1H-1,2,4-triazol-3-amine |
| InChIKey | WKTGLFHOWNWTRI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=NC(=NN2)N)F |
Computed by PubChem (NCBI)