CAS 1210419-29-6 is the registry number for Methyl 6-(2,6-difluoro-4-methoxyphenyl)-5-fluoropicolinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6-(2,6-difluoro-4-methoxyphenyl)-5-fluoropyridine-2-carboxylate (CAS 1210419-29-6) is a chemical compound with the molecular formula C14H10F3NO3 and a molecular weight of 297.23 g/mol. IUPAC name: methyl 6-(2,6-difluoro-4-methoxyphenyl)-5-fluoropyridine-2-carboxylate. InChIKey: TZWQAHFVGAUZLI-UHFFFAOYSA-N.
| Molecular formula | C14H10F3NO3 |
|---|---|
| Molecular weight | 297.23 g/mol |
| IUPAC name | methyl 6-(2,6-difluoro-4-methoxyphenyl)-5-fluoropyridine-2-carboxylate |
| InChIKey | TZWQAHFVGAUZLI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)F)C2=C(C=CC(=N2)C(=O)OC)F)F |
Computed by PubChem (NCBI)