CAS 338783-75-8 appears in our catalog under these names: 6-Oxo-1-(4-(trifluoromethyl)benzyl)-1,6-dihydropyridine-3-carboxylic acid, 97%, 6-Oxo-1-[4-(trifluoromethyl)benzyl]-1,6-dihydro-3-pyridinecarboxylic acid. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 250mg, 500mg.
6-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]pyridine-3-carboxylic acid (CAS 338783-75-8) is a chemical compound with the molecular formula C14H10F3NO3 and a molecular weight of 297.23 g/mol. IUPAC name: 6-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]pyridine-3-carboxylic acid. InChIKey: YQPYIHMFARMRGV-UHFFFAOYSA-N.
| Molecular formula | C14H10F3NO3 |
|---|---|
| Molecular weight | 297.23 g/mol |
| IUPAC name | 6-oxo-1-[[4-(trifluoromethyl)phenyl]methyl]pyridine-3-carboxylic acid |
| InChIKey | YQPYIHMFARMRGV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=C(C=CC2=O)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)