CAS 338754-66-8 is the registry number for 2-Oxo-1-[3-(trifluoromethyl)benzyl]-1,2-dihydro-3-pyridinecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyridine-3-carboxylic acid (CAS 338754-66-8) is a chemical compound with the molecular formula C14H10F3NO3 and a molecular weight of 297.23 g/mol. IUPAC name: 2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyridine-3-carboxylic acid. InChIKey: YUYOYZFKVQRFTI-UHFFFAOYSA-N.
| Molecular formula | C14H10F3NO3 |
|---|---|
| Molecular weight | 297.23 g/mol |
| IUPAC name | 2-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyridine-3-carboxylic acid |
| InChIKey | YUYOYZFKVQRFTI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CN2C=CC=C(C2=O)C(=O)O |
Computed by PubChem (NCBI)