CAS 2379883-79-9 appears in our catalog under these names: Des-((E)-Methyl-3-methyoxyacrylate) Picoxystrobin, >95% (HPLC), Picoxystrobin metabolite M8, Picoxystrobin M8. Offered by: TRC, Dr. Ehrenstorfer, Biosynth, HPC Standards. Available pack sizes: 100mg, 250mg, 25mg, 10mg, 500mg, 1x10mg.
2-[[6-(trifluoromethyl)-2-pyridinyl]oxymethyl]benzoic acid (CAS 2379883-79-9) is a chemical compound with the molecular formula C14H10F3NO3 and a molecular weight of 297.23 g/mol. IUPAC name: 2-[[6-(trifluoromethyl)-2-pyridinyl]oxymethyl]benzoic acid. InChIKey: SCASTWHLUHBICN-UHFFFAOYSA-N.
| Molecular formula | C14H10F3NO3 |
|---|---|
| Molecular weight | 297.23 g/mol |
| IUPAC name | 2-[[6-(trifluoromethyl)-2-pyridinyl]oxymethyl]benzoic acid |
| InChIKey | SCASTWHLUHBICN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC2=CC=CC(=N2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)