Products 1261451-16-4

CAS 1261451-16-4 is the registry number for 3-(4-(Trifluoromethoxy)phenyl)isonicotinic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 3-[4-(trifluoromethoxy)phenyl]pyridine-4-carboxylate (CAS 1261451-16-4) is a chemical compound with the molecular formula C14H10F3NO3 and a molecular weight of 297.23 g/mol. IUPAC name: methyl 3-[4-(trifluoromethoxy)phenyl]pyridine-4-carboxylate. InChIKey: OAGAGYJNQPKFHU-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10F3NO3
Molecular weight297.23 g/mol
IUPAC namemethyl 3-[4-(trifluoromethoxy)phenyl]pyridine-4-carboxylate
InChIKeyOAGAGYJNQPKFHU-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=NC=C1)C2=CC=C(C=C2)OC(F)(F)F

Computed by PubChem (NCBI)