CAS 121048-67-7 is the registry number for Metoclopramide Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-amino-3-chloro-2-methoxybenzoate (CAS 121048-67-7) is a chemical compound with the molecular formula C9H10ClNO3 and a molecular weight of 215.63 g/mol. IUPAC name: methyl 4-amino-3-chloro-2-methoxybenzoate. InChIKey: FNEVHJDGKINRLL-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO3 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | methyl 4-amino-3-chloro-2-methoxybenzoate |
| InChIKey | FNEVHJDGKINRLL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1Cl)N)C(=O)OC |
Computed by PubChem (NCBI)