CAS 1210510-50-1 is the registry number for [1-(2,5-Dimethyl-1,3-thiazol-4-yl)ethyl]methylamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.
1-(2,5-dimethyl-1,3-thiazol-4-yl)-N-methylethanamine;dihydrochloride (CAS 1210510-50-1) is a chemical compound with the molecular formula C8H16Cl2N2S and a molecular weight of 243.20 g/mol. IUPAC name: 1-(2,5-dimethyl-1,3-thiazol-4-yl)-N-methylethanamine;dihydrochloride. InChIKey: PTDFIVFSTWDCFH-UHFFFAOYSA-N.
| Molecular formula | C8H16Cl2N2S |
|---|---|
| Molecular weight | 243.20 g/mol |
| IUPAC name | 1-(2,5-dimethyl-1,3-thiazol-4-yl)-N-methylethanamine;dihydrochloride |
| InChIKey | PTDFIVFSTWDCFH-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)C)C(C)NC.Cl.Cl |
Computed by PubChem (NCBI)