Products 1332529-33-5
CAS 1332529-33-5 appears in our catalog under these names: N-[(4-Methyl-1,3-thiazol-2-yl)methyl]propan-2-amine dihydrochloride, 95%, N-((4-MEthyl-1,3-thiazol-2-yl)methyl)propan-2-amine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
N-[(4-methyl-1,3-thiazol-2-yl)methyl]propan-2-amine;dihydrochloride (CAS 1332529-33-5) is a chemical compound with the molecular formula C8H16Cl2N2S and a molecular weight of 243.20 g/mol. IUPAC name: N-[(4-methyl-1,3-thiazol-2-yl)methyl]propan-2-amine;dihydrochloride. InChIKey: PWRBVSLZDPPDTF-UHFFFAOYSA-N.
| Molecular formula | C8H16Cl2N2S |
|---|---|
| Molecular weight | 243.20 g/mol |
| IUPAC name | N-[(4-methyl-1,3-thiazol-2-yl)methyl]propan-2-amine;dihydrochloride |
| InChIKey | PWRBVSLZDPPDTF-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)CNC(C)C.Cl.Cl |
Computed by PubChem (NCBI)