CAS 1396759-29-7 is the registry number for [2-(4-Isopropyl-1,3-thiazol-2-yl)ethyl]amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
2-(4-propan-2-yl-1,3-thiazol-2-yl)ethanamine;dihydrochloride (CAS 1396759-29-7) is a chemical compound with the molecular formula C8H16Cl2N2S and a molecular weight of 243.20 g/mol. IUPAC name: 2-(4-propan-2-yl-1,3-thiazol-2-yl)ethanamine;dihydrochloride. InChIKey: WMILCPGLUOMVQF-UHFFFAOYSA-N.
| Molecular formula | C8H16Cl2N2S |
|---|---|
| Molecular weight | 243.20 g/mol |
| IUPAC name | 2-(4-propan-2-yl-1,3-thiazol-2-yl)ethanamine;dihydrochloride |
| InChIKey | WMILCPGLUOMVQF-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CSC(=N1)CCN.Cl.Cl |
Computed by PubChem (NCBI)