CAS 1269036-78-3 appears in our catalog under these names: [(4-tert-Butyl-1,3-thiazol-2-yl)methyl]amine dihydrochloride, 95%, ((4-tert-Butyl-1,3-thiazol-2-yl)methyl)amine dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
(4-tert-butyl-1,3-thiazol-2-yl)methanamine;dihydrochloride (CAS 1269036-78-3) is a chemical compound with the molecular formula C8H16Cl2N2S and a molecular weight of 243.20 g/mol. IUPAC name: (4-tert-butyl-1,3-thiazol-2-yl)methanamine;dihydrochloride. InChIKey: SCVQRWUOGIOZQD-UHFFFAOYSA-N.
| Molecular formula | C8H16Cl2N2S |
|---|---|
| Molecular weight | 243.20 g/mol |
| IUPAC name | (4-tert-butyl-1,3-thiazol-2-yl)methanamine;dihydrochloride |
| InChIKey | SCVQRWUOGIOZQD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CSC(=N1)CN.Cl.Cl |
Computed by PubChem (NCBI)