CAS 1306603-67-7 is the registry number for 1-(2-(Propan-2-yl)-1,3-thiazol-4-yl)ethan-1-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2-propan-2-yl-1,3-thiazol-4-yl)ethanamine;dihydrochloride (CAS 1306603-67-7) is a chemical compound with the molecular formula C8H16Cl2N2S and a molecular weight of 243.20 g/mol. IUPAC name: 1-(2-propan-2-yl-1,3-thiazol-4-yl)ethanamine;dihydrochloride. InChIKey: RWYOZNHMIHGARZ-UHFFFAOYSA-N.
| Molecular formula | C8H16Cl2N2S |
|---|---|
| Molecular weight | 243.20 g/mol |
| IUPAC name | 1-(2-propan-2-yl-1,3-thiazol-4-yl)ethanamine;dihydrochloride |
| InChIKey | RWYOZNHMIHGARZ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC(=CS1)C(C)N.Cl.Cl |
Computed by PubChem (NCBI)