CAS 1210918-13-0 appears in our catalog under these names: 3,5-Dihydro-2H-thieno(2,3-c)pyrrole-4-sulfonyl chloride 1,1-dioxide, 95%, 3,​5-Dihydro-​2H-​thieno(2,​3-​c)​pyrrole-​4-​sulfonyl chloride 1,​1-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1,1-dioxo-3,5-dihydro-2H-thieno[2,3-c]pyrrole-4-sulfonyl chloride (CAS 1210918-13-0) is a chemical compound with the molecular formula C6H6ClNO4S2 and a molecular weight of 255.7 g/mol. IUPAC name: 1,1-dioxo-3,5-dihydro-2H-thieno[2,3-c]pyrrole-4-sulfonyl chloride. InChIKey: YQIDYDXPPYGKDH-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO4S2 |
|---|---|
| Molecular weight | 255.7 g/mol |
| IUPAC name | 1,1-dioxo-3,5-dihydro-2H-thieno[2,3-c]pyrrole-4-sulfonyl chloride |
| InChIKey | YQIDYDXPPYGKDH-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C2=CNC(=C21)S(=O)(=O)Cl |
Computed by PubChem (NCBI)