Products 2138032-39-8

CAS 2138032-39-8 appears in our catalog under these names: 2-(1,3-Dioxolan-2-yl)thiazole-5-sulfonyl chloride, 98%, 2-(1,3-Dioxolan-2-yl)-1,3-thiazole-5-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.

2-(1,3-dioxolan-2-yl)-1,3-thiazole-5-sulfonyl chloride (CAS 2138032-39-8) is a chemical compound with the molecular formula C6H6ClNO4S2 and a molecular weight of 255.7 g/mol. IUPAC name: 2-(1,3-dioxolan-2-yl)-1,3-thiazole-5-sulfonyl chloride. InChIKey: QZOQHZCMVWKMFA-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6ClNO4S2
Molecular weight255.7 g/mol
IUPAC name2-(1,3-dioxolan-2-yl)-1,3-thiazole-5-sulfonyl chloride
InChIKeyQZOQHZCMVWKMFA-UHFFFAOYSA-N
SMILESC1COC(O1)C2=NC=C(S2)S(=O)(=O)Cl

Computed by PubChem (NCBI)