Products 46249-41-6
CAS 46249-41-6 is the registry number for 4-(Aminosulfonyl)benzenesulfonyl chloride, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
4-sulfamoylbenzenesulfonyl chloride (CAS 46249-41-6) is a chemical compound with the molecular formula C6H6ClNO4S2 and a molecular weight of 255.7 g/mol. IUPAC name: 4-sulfamoylbenzenesulfonyl chloride. InChIKey: LLFQHNCOIPUFIJ-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO4S2 |
|---|---|
| Molecular weight | 255.7 g/mol |
| IUPAC name | 4-sulfamoylbenzenesulfonyl chloride |
| InChIKey | LLFQHNCOIPUFIJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1S(=O)(=O)N)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
4-Sulfamoylbenzene-1-sulfonyl chloride, 4-(aminosulfonyl)benzenesulfonyl chloride, 4-sulfamoylbenzenesulfonyl Chloride, Benzenesulfonylchloride, 4-(aminosulfonyl)-, Benzenesulfonyl chloride, 4-(aminosulfonyl)-, 4-sulfamoylbenzenesulphonyl chloride, 4-Sulfamoyl-benzenesulfonyl chloride, 4-Sulfamoylbenzene-1-sulfonylchloride, 4-(aminosulfonyl)benzenesulfonyl chloride, AldrichCPR