CAS 70374-36-6 appears in our catalog under these names: Lornoxicam Impurity 1, Lornoxicam Impurity 10, 5-Chloro-3-((methylamino)sulfonyl)-2-thiophenecarboxylic Acid, >95% (HPLC), 5-Chloro-3-(N-methylsulfamoyl)thiophene-2-carboxylic acid. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 250mg, 25mg, 0,5g, 50mg.
5-chloro-3-(methylsulfamoyl)thiophene-2-carboxylic acid (CAS 70374-36-6) is a chemical compound with the molecular formula C6H6ClNO4S2 and a molecular weight of 255.7 g/mol. IUPAC name: 5-chloro-3-(methylsulfamoyl)thiophene-2-carboxylic acid. InChIKey: SRXBPROHRKDGBA-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO4S2 |
|---|---|
| Molecular weight | 255.7 g/mol |
| IUPAC name | 5-chloro-3-(methylsulfamoyl)thiophene-2-carboxylic acid |
| InChIKey | SRXBPROHRKDGBA-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=C(SC(=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)