CAS 1935906-16-3 is the registry number for Methyl 2-(chlorosulfonyl)-4-methylthiazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-chlorosulfonyl-4-methyl-1,3-thiazole-5-carboxylate (CAS 1935906-16-3) is a chemical compound with the molecular formula C6H6ClNO4S2 and a molecular weight of 255.7 g/mol. IUPAC name: methyl 2-chlorosulfonyl-4-methyl-1,3-thiazole-5-carboxylate. InChIKey: SOPIFCGSALLDMT-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO4S2 |
|---|---|
| Molecular weight | 255.7 g/mol |
| IUPAC name | methyl 2-chlorosulfonyl-4-methyl-1,3-thiazole-5-carboxylate |
| InChIKey | SOPIFCGSALLDMT-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)S(=O)(=O)Cl)C(=O)OC |
Computed by PubChem (NCBI)