Products 1211096-65-9
CAS 1211096-65-9 is the registry number for 4,4,4-Trifluoro-3-hydroxy-3-(1H-imidazol-2-yl)butanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4,4,4-trifluoro-3-hydroxy-3-(1H-imidazol-2-yl)butanoic acid (CAS 1211096-65-9) is a chemical compound with the molecular formula C7H7F3N2O3 and a molecular weight of 224.14 g/mol. IUPAC name: 4,4,4-trifluoro-3-hydroxy-3-(1H-imidazol-2-yl)butanoic acid. InChIKey: DOSITXNCMGQCHR-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N2O3 |
|---|---|
| Molecular weight | 224.14 g/mol |
| IUPAC name | 4,4,4-trifluoro-3-hydroxy-3-(1H-imidazol-2-yl)butanoic acid |
| InChIKey | DOSITXNCMGQCHR-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N1)C(CC(=O)O)(C(F)(F)F)O |
Computed by PubChem (NCBI)