Products 1211145-29-7
CAS 1211145-29-7 appears in our catalog under these names: N-(2-Aminopropyl)-N-methylaniline dihydrochloride, 95%, N-(2-Aminopropyl)-N-methylaniline dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-N-methyl-1-N-phenylpropane-1,2-diamine;dihydrochloride (CAS 1211145-29-7) is a chemical compound with the molecular formula C10H18Cl2N2 and a molecular weight of 237.17 g/mol. IUPAC name: 1-N-methyl-1-N-phenylpropane-1,2-diamine;dihydrochloride. InChIKey: LXZCZTDZMPXQLZ-UHFFFAOYSA-N.
| Molecular formula | C10H18Cl2N2 |
|---|---|
| Molecular weight | 237.17 g/mol |
| IUPAC name | 1-N-methyl-1-N-phenylpropane-1,2-diamine;dihydrochloride |
| InChIKey | LXZCZTDZMPXQLZ-UHFFFAOYSA-N |
| SMILES | CC(CN(C)C1=CC=CC=C1)N.Cl.Cl |
Computed by PubChem (NCBI)