Products 1211362-38-7
CAS 1211362-38-7 is the registry number for 1-(4-Acetyl-3-ethyl-5-methyl-1H-pyrrol-2-yl)-2-chloroethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(4-acetyl-3-ethyl-5-methyl-1H-pyrrol-2-yl)-2-chloroethanone (CAS 1211362-38-7) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: 1-(4-acetyl-3-ethyl-5-methyl-1H-pyrrol-2-yl)-2-chloroethanone. InChIKey: UTWJOFFJBWRUNA-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 1-(4-acetyl-3-ethyl-5-methyl-1H-pyrrol-2-yl)-2-chloroethanone |
| InChIKey | UTWJOFFJBWRUNA-UHFFFAOYSA-N |
| SMILES | CCC1=C(NC(=C1C(=O)C)C)C(=O)CCl |
Computed by PubChem (NCBI)