Products 1211409-49-2
CAS 1211409-49-2 appears in our catalog under these names: 1-Benzyl-3-methyl-1H-pyrazolo(3,4-b)pyridin-5-amine, 95%, 1-Benzyl-3-methyl-1H-pyrazolo(3,4-b)pyridin-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
1-benzyl-3-methylpyrazolo[5,4-b]pyridin-5-amine (CAS 1211409-49-2) is a chemical compound with the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. IUPAC name: 1-benzyl-3-methylpyrazolo[5,4-b]pyridin-5-amine. InChIKey: FTWIGHVVRPSPRQ-UHFFFAOYSA-N.
| Molecular formula | C14H14N4 |
|---|---|
| Molecular weight | 238.29 g/mol |
| IUPAC name | 1-benzyl-3-methylpyrazolo[5,4-b]pyridin-5-amine |
| InChIKey | FTWIGHVVRPSPRQ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=C(C=N2)N)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)