CAS 1211520-91-0 is the registry number for 6-Bromo-3-nitropicolinic acid 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
6-bromo-3-nitropyridine-2-carboxylic acid (CAS 1211520-91-0) is a chemical compound with the molecular formula C6H3BrN2O4 and a molecular weight of 247.00 g/mol. IUPAC name: 6-bromo-3-nitropyridine-2-carboxylic acid. InChIKey: BMRNHERMMLNEHO-UHFFFAOYSA-N.
| Molecular formula | C6H3BrN2O4 |
|---|---|
| Molecular weight | 247.00 g/mol |
| IUPAC name | 6-bromo-3-nitropyridine-2-carboxylic acid |
| InChIKey | BMRNHERMMLNEHO-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1[N+](=O)[O-])C(=O)O)Br |
Computed by PubChem (NCBI)