Products 1211578-33-4
CAS 1211578-33-4 appears in our catalog under these names: 6-Bromo-5-nitropyridine-2-carboxylic acid, 6-Bromo-5-nitropyridine-2-carboxylic Acid, ≥97%. Offered by: Biosynth, Chemat. Available pack sizes: 1g, 100mg, 250mg.
6-bromo-5-nitropyridine-2-carboxylic acid (CAS 1211578-33-4) is a chemical compound with the molecular formula C6H3BrN2O4 and a molecular weight of 247.00 g/mol. IUPAC name: 6-bromo-5-nitropyridine-2-carboxylic acid. InChIKey: RWDVNWYGZAUUDG-UHFFFAOYSA-N.
| Molecular formula | C6H3BrN2O4 |
|---|---|
| Molecular weight | 247.00 g/mol |
| IUPAC name | 6-bromo-5-nitropyridine-2-carboxylic acid |
| InChIKey | RWDVNWYGZAUUDG-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1[N+](=O)[O-])Br)C(=O)O |
Computed by PubChem (NCBI)